CAS 84467-54-9 appears in our catalog under these names: Didesmethyl Sibutramine, >95% (HPLC), Didesmethyl sibutramine, 1-(1-(4-Chlorophenyl)Cyclobutyl)-3-Methylbutan-1-Amine, 95%, 95%. Offered by: TRC, Biosynth, Chemat. Available pack sizes: 10mg, 50mg, 5mg, 25mg, 100mg.
1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutan-1-amine (CAS 84467-54-9) is a chemical compound with the molecular formula C15H22ClN and a molecular weight of 251.79 g/mol. IUPAC name: 1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutan-1-amine. InChIKey: WQSACWZKKZPCHN-UHFFFAOYSA-N.
| Molecular formula | C15H22ClN |
|---|---|
| Molecular weight | 251.79 g/mol |
| IUPAC name | 1-[1-(4-chlorophenyl)cyclobutyl]-3-methylbutan-1-amine |
| InChIKey | WQSACWZKKZPCHN-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C1(CCC1)C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)