CAS 1189863-10-2 is the registry number for 8-Hydroxy Loxapine-d3. Offered by: TRC. Available pack sizes: 25mg.
8-chloro-6-[4-(trideuteriomethyl)piperazin-1-yl]benzo[b][1,4]benzoxazepin-3-ol (CAS 1189863-10-2) is a chemical compound with the molecular formula C18H18ClN3O2 and a molecular weight of 346.8 g/mol. IUPAC name: 8-chloro-6-[4-(trideuteriomethyl)piperazin-1-yl]benzo[b][1,4]benzoxazepin-3-ol. InChIKey: VNJRIWXLPIYFGI-FIBGUPNXSA-N.
| Molecular formula | C18H18ClN3O2 |
|---|---|
| Molecular weight | 346.8 g/mol |
| IUPAC name | 8-chloro-6-[4-(trideuteriomethyl)piperazin-1-yl]benzo[b][1,4]benzoxazepin-3-ol |
| InChIKey | VNJRIWXLPIYFGI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)C2=NC3=C(C=CC(=C3)O)OC4=C2C=C(C=C4)Cl |
Computed by PubChem (NCBI)