CAS 25967-34-4 appears in our catalog under these names: Loxapine N-Oxide, Loxapine N-Oxide, >95% (HPLC). Offered by: Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: on request, 100mg, 10mg, 50mg, 25mg.
8-chloro-6-(4-methyl-4-oxidopiperazin-4-ium-1-yl)benzo[b][1,4]benzoxazepine (CAS 25967-34-4) is a chemical compound with the molecular formula C18H18ClN3O2 and a molecular weight of 343.8 g/mol. IUPAC name: 8-chloro-6-(4-methyl-4-oxidopiperazin-4-ium-1-yl)benzo[b][1,4]benzoxazepine. InChIKey: QUSWANHLDLADDR-UHFFFAOYSA-N.
| Molecular formula | C18H18ClN3O2 |
|---|---|
| Molecular weight | 343.8 g/mol |
| IUPAC name | 8-chloro-6-(4-methyl-4-oxidopiperazin-4-ium-1-yl)benzo[b][1,4]benzoxazepine |
| InChIKey | QUSWANHLDLADDR-UHFFFAOYSA-N |
| SMILES | C[N+]1(CCN(CC1)C2=NC3=CC=CC=C3OC4=C2C=C(C=C4)Cl)[O-] |
Computed by PubChem (NCBI)