CAS 37081-75-7 is the registry number for 7-Hydroxy Loxapine, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
8-chloro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-2-ol (CAS 37081-75-7) is a chemical compound with the molecular formula C18H18ClN3O2 and a molecular weight of 343.8 g/mol. IUPAC name: 8-chloro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-2-ol. InChIKey: CFHDISFPIIFJTI-UHFFFAOYSA-N.
| Molecular formula | C18H18ClN3O2 |
|---|---|
| Molecular weight | 343.8 g/mol |
| IUPAC name | 8-chloro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-2-ol |
| InChIKey | CFHDISFPIIFJTI-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC3=C(C=C(C=C3)O)OC4=C2C=C(C=C4)Cl |
Computed by PubChem (NCBI)