Products 1189877-07-3
CAS 1189877-07-3 appears in our catalog under these names: Cyclobenzaprine Impurity 7-d3, Cyclobenzaprine-d3 N-Oxide, Cyclobenzaprine N-oxide-d3. Offered by: Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 25 mg, 10 mg, 1 mg.
N-methyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)-N-(trideuteriomethyl)propan-1-amine oxide (CAS 1189877-07-3) is a chemical compound with the molecular formula C20H21NO and a molecular weight of 294.4 g/mol. IUPAC name: N-methyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)-N-(trideuteriomethyl)propan-1-amine oxide. InChIKey: CWVULMRJHWMZLY-FIBGUPNXSA-N.
| Molecular formula | C20H21NO |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | N-methyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)-N-(trideuteriomethyl)propan-1-amine oxide |
| InChIKey | CWVULMRJHWMZLY-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])[N+](C)(CCC=C1C2=CC=CC=C2C=CC3=CC=CC=C31)[O-] |
Computed by PubChem (NCBI)