CAS 30235-48-4 appears in our catalog under these names: Cyclobenzaprine Impurity 4, 3-Hydroxy Cyclobenzaprine. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
(2Z)-2-[3-(dimethylamino)propylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-5-ol (CAS 30235-48-4) is a chemical compound with the molecular formula C20H21NO and a molecular weight of 291.4 g/mol. IUPAC name: (2Z)-2-[3-(dimethylamino)propylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-5-ol. InChIKey: UHLPYBQGKLHIFK-UWVJOHFNSA-N.
| Molecular formula | C20H21NO |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | (2Z)-2-[3-(dimethylamino)propylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-5-ol |
| InChIKey | UHLPYBQGKLHIFK-UWVJOHFNSA-N |
| SMILES | CN(C)CC/C=C\1/C2=CC=CC=C2C=CC3=C1C=C(C=C3)O |
Computed by PubChem (NCBI)