CAS 6682-26-4 appears in our catalog under these names: Cyclobenzaprine N-Oxide, Cyclobenzaprine Impurity 7, Cyclobenzaprine N-Oxide, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 10 mg.
N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propan-1-amine oxide (CAS 6682-26-4) is a chemical compound with the molecular formula C20H21NO and a molecular weight of 291.4 g/mol. IUPAC name: N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propan-1-amine oxide. InChIKey: CWVULMRJHWMZLY-UHFFFAOYSA-N.
| Molecular formula | C20H21NO |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propan-1-amine oxide |
| InChIKey | CWVULMRJHWMZLY-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCC=C1C2=CC=CC=C2C=CC3=CC=CC=C31)[O-] |
Computed by PubChem (NCBI)