CAS 1189877-28-8 appears in our catalog under these names: 4-(Methylnitrosamino)-1-(3-pyridyl)-1-butanol-1,2',3',4',5',6'-13C6, 4-(Methylnitrosamino)-1-(3-pyridyl)-1-butanol-1,2’,3’,4’,5’,6’-13C6. Offered by: TRC. Available pack sizes: 0,25mg, 1mg.
N-[4-hydroxy-4-(3-pyridinyl)(413C)butyl]-N-methylnitrous amide (CAS 1189877-28-8) is a chemical compound with the molecular formula C10H15N3O2 and a molecular weight of 215.20 g/mol. IUPAC name: N-[4-hydroxy-4-(3-pyridinyl)(413C)butyl]-N-methylnitrous amide. InChIKey: OGRXKBUCZFFSTL-NXGVJODUSA-N.
| Molecular formula | C10H15N3O2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | N-[4-hydroxy-4-(3-pyridinyl)(413C)butyl]-N-methylnitrous amide |
| InChIKey | OGRXKBUCZFFSTL-NXGVJODUSA-N |
| SMILES | CN(CCC[13CH]([13C]1=[13CH]N=[13CH][13CH]=[13CH]1)O)N=O |
Computed by PubChem (NCBI)