CAS 163213-19-2 appears in our catalog under these names: tert-Butyl 6-hydrazinylnicotinate, 95%, tert-Butyl 6-hydrazinylnicotinate, 97%, 97%, tert-Butyl 6-hydrazinylnicotinate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
Tert-butyl 6-hydrazinylpyridine-3-carboxylate (CAS 163213-19-2) is a chemical compound with the molecular formula C10H15N3O2 and a molecular weight of 209.24 g/mol. IUPAC name: tert-butyl 6-hydrazinylpyridine-3-carboxylate. InChIKey: LGHKHMSCVFCTRZ-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O2 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | tert-butyl 6-hydrazinylpyridine-3-carboxylate |
| InChIKey | LGHKHMSCVFCTRZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CN=C(C=C1)NN |
Computed by PubChem (NCBI)