CAS 1794885-45-2 is the registry number for 4-(Methylnitrosamino)-1-(3-pyridyl)-1-butanol-d5, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
N-(1,1-dideuterio-4-hydroxy-4-pyridin-3-ylbutyl)-N-(trideuteriomethyl)nitrous amide (CAS 1794885-45-2) is a chemical compound with the molecular formula C10H15N3O2 and a molecular weight of 214.28 g/mol. IUPAC name: N-(1,1-dideuterio-4-hydroxy-4-pyridin-3-ylbutyl)-N-(trideuteriomethyl)nitrous amide. InChIKey: OGRXKBUCZFFSTL-WRMAMSRYSA-N.
| Molecular formula | C10H15N3O2 |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | N-(1,1-dideuterio-4-hydroxy-4-pyridin-3-ylbutyl)-N-(trideuteriomethyl)nitrous amide |
| InChIKey | OGRXKBUCZFFSTL-WRMAMSRYSA-N |
| SMILES | [2H]C([2H])([2H])N(C([2H])([2H])CCC(C1=CN=CC=C1)O)N=O |
Computed by PubChem (NCBI)