Products 1189892-05-4
CAS 1189892-05-4 is the registry number for 2-Hydroxy-4-phenylbutyric Acid Ethyl Ester-d5. Offered by: TRC. Available pack sizes: 50mg, 5mg.
Ethyl 2-hydroxy-4-(2,3,4,5,6-pentadeuteriophenyl)butanoate (CAS 1189892-05-4) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 213.28 g/mol. IUPAC name: ethyl 2-hydroxy-4-(2,3,4,5,6-pentadeuteriophenyl)butanoate. InChIKey: ZJYKSSGYDPNKQS-DKFMXDSJSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 213.28 g/mol |
| IUPAC name | ethyl 2-hydroxy-4-(2,3,4,5,6-pentadeuteriophenyl)butanoate |
| InChIKey | ZJYKSSGYDPNKQS-DKFMXDSJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CCC(C(=O)OCC)O)[2H])[2H] |
Computed by PubChem (NCBI)