Products 1189903-32-9
CAS 1189903-32-9 is the registry number for Benzyl Fentanyl–d3. Offered by: GLPBio. Available pack sizes: 50mg.
N-(1-benzylpiperidin-4-yl)-3,3,3-trideuterio-N-phenylpropanamide (CAS 1189903-32-9) is a chemical compound with the molecular formula C21H26N2O and a molecular weight of 325.5 g/mol. IUPAC name: N-(1-benzylpiperidin-4-yl)-3,3,3-trideuterio-N-phenylpropanamide. InChIKey: POQDXIFVWVZVML-FIBGUPNXSA-N.
| Molecular formula | C21H26N2O |
|---|---|
| Molecular weight | 325.5 g/mol |
| IUPAC name | N-(1-benzylpiperidin-4-yl)-3,3,3-trideuterio-N-phenylpropanamide |
| InChIKey | POQDXIFVWVZVML-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC(=O)N(C1CCN(CC1)CC2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
Benzyl Fentanyl-d3