CAS 1189917-36-9 appears in our catalog under these names: 10,11-Dihydro-10-hydroxy Carbamazepine-d3, >95% (HPLC), Licarbazepine–d3, Licarbazepine-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
5,6,6-trideuterio-5-hydroxybenzo[b][1]benzazepine-11-carboxamide (CAS 1189917-36-9) is a chemical compound with the molecular formula C15H14N2O2 and a molecular weight of 257.30 g/mol. IUPAC name: 5,6,6-trideuterio-5-hydroxybenzo[b][1]benzazepine-11-carboxamide. InChIKey: BMPDWHIDQYTSHX-BAVZAHHNSA-N.
| Molecular formula | C15H14N2O2 |
|---|---|
| Molecular weight | 257.30 g/mol |
| IUPAC name | 5,6,6-trideuterio-5-hydroxybenzo[b][1]benzazepine-11-carboxamide |
| InChIKey | BMPDWHIDQYTSHX-BAVZAHHNSA-N |
| SMILES | [2H]C1(C2=CC=CC=C2N(C3=CC=CC=C3C1([2H])O)C(=O)N)[2H] |
Computed by PubChem (NCBI)