CAS 1189922-22-2 appears in our catalog under these names: 2-[4-(4-Fluorophenyl)phenyl]ethylamine hydrochloride, 98%, 2-(4-(4-Fluorophenyl)phenyl)ethylamine, HCl, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 25g, 1g.
2-[4-(4-fluorophenyl)phenyl]ethanamine;hydrochloride (CAS 1189922-22-2) is a chemical compound with the molecular formula C14H15ClFN and a molecular weight of 251.72 g/mol. IUPAC name: 2-[4-(4-fluorophenyl)phenyl]ethanamine;hydrochloride. InChIKey: FQLJVLOQYYHIIV-UHFFFAOYSA-N.
| Molecular formula | C14H15ClFN |
|---|---|
| Molecular weight | 251.72 g/mol |
| IUPAC name | 2-[4-(4-fluorophenyl)phenyl]ethanamine;hydrochloride |
| InChIKey | FQLJVLOQYYHIIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCN)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)