CAS 79314-49-1 appears in our catalog under these names: 2-(4-Fluorophenyl)-2-phenylethylamine hydrochloride, 95%, 2-(4-Fluorophenyl)-2-phenylethanamine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
2-(4-fluorophenyl)-2-phenylethanamine;hydrochloride (CAS 79314-49-1) is a chemical compound with the molecular formula C14H15ClFN and a molecular weight of 251.72 g/mol. IUPAC name: 2-(4-fluorophenyl)-2-phenylethanamine;hydrochloride. InChIKey: IXMWRYOJMBHXBI-UHFFFAOYSA-N.
| Molecular formula | C14H15ClFN |
|---|---|
| Molecular weight | 251.72 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-2-phenylethanamine;hydrochloride |
| InChIKey | IXMWRYOJMBHXBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CN)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)