CAS 2780360-98-5 is the registry number for 1-Chloro-7-fluoro-6-neopentylisoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-6-(2,2-dimethylpropyl)-7-fluoroisoquinoline (CAS 2780360-98-5) is a chemical compound with the molecular formula C14H15ClFN and a molecular weight of 251.72 g/mol. IUPAC name: 1-chloro-6-(2,2-dimethylpropyl)-7-fluoroisoquinoline. InChIKey: OQYVBXWLYBFBMJ-UHFFFAOYSA-N.
| Molecular formula | C14H15ClFN |
|---|---|
| Molecular weight | 251.72 g/mol |
| IUPAC name | 1-chloro-6-(2,2-dimethylpropyl)-7-fluoroisoquinoline |
| InChIKey | OQYVBXWLYBFBMJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC1=C(C=C2C(=C1)C=CN=C2Cl)F |
Computed by PubChem (NCBI)