Products 1189927-81-8
CAS 1189927-81-8 appears in our catalog under these names: 2-Butyl-d3-4-chloro-1H-imidazole-5-carboxaldehyde, 2-Butyl-4-chloro-5-formylimidazole-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
5-chloro-2-(4,4,4-trideuteriobutyl)-1H-imidazole-4-carbaldehyde (CAS 1189927-81-8) is a chemical compound with the molecular formula C8H11ClN2O and a molecular weight of 189.66 g/mol. IUPAC name: 5-chloro-2-(4,4,4-trideuteriobutyl)-1H-imidazole-4-carbaldehyde. InChIKey: JLVIHQCWASNXCK-FIBGUPNXSA-N.
| Molecular formula | C8H11ClN2O |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | 5-chloro-2-(4,4,4-trideuteriobutyl)-1H-imidazole-4-carbaldehyde |
| InChIKey | JLVIHQCWASNXCK-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CCCC1=NC(=C(N1)Cl)C=O |
Computed by PubChem (NCBI)