CAS 1189954-79-7 appears in our catalog under these names: Nicotinic Acid-13C6, >95% (HPLC), Nicotinic Acid-13C6 (100 μg/ml in methanol), Niacin–13C6, NICOTINIC ACID-13C6, 99 ATOM % 13C, Niacin-13C6, 98.0%, 98.0%. Offered by: TRC, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1mg, 1x1ml, 2x1ml, 5x1ml, 10MG, 1 mg.
(2,3,4,5,6-13C5)pyridine-3-carboxylic acid (CAS 1189954-79-7) is a chemical compound with the molecular formula C6H5NO2 and a molecular weight of 129.066 g/mol. IUPAC name: (2,3,4,5,6-13C5)pyridine-3-carboxylic acid. InChIKey: PVNIIMVLHYAWGP-IDEBNGHGSA-N.
| Molecular formula | C6H5NO2 |
|---|---|
| Molecular weight | 129.066 g/mol |
| IUPAC name | (2,3,4,5,6-13C5)pyridine-3-carboxylic acid |
| InChIKey | PVNIIMVLHYAWGP-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH]N=[13CH]1)[13C](=O)O |
Computed by PubChem (NCBI)