Products 2483829-87-2
CAS 2483829-87-2 is the registry number for Niacin-15N,13C3. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(2,6-13C2,115N)pyridine-3-carboxylic acid (CAS 2483829-87-2) is a chemical compound with the molecular formula C6H5NO2 and a molecular weight of 127.08 g/mol. IUPAC name: (2,6-13C2,115N)pyridine-3-carboxylic acid. InChIKey: PVNIIMVLHYAWGP-HNZXROKESA-N.
| Molecular formula | C6H5NO2 |
|---|---|
| Molecular weight | 127.08 g/mol |
| IUPAC name | (2,6-13C2,115N)pyridine-3-carboxylic acid |
| InChIKey | PVNIIMVLHYAWGP-HNZXROKESA-N |
| SMILES | C1=CC(=[13CH][15N]=[13CH]1)[13C](=O)O |
Computed by PubChem (NCBI)