CAS 1189957-99-0 appears in our catalog under these names: Betaxolol-d5 HCl, Betaxolol-d5, >95% (HPLC), Betaxolol–d5, Betaxolol-d5. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-1,1,2,3,3-pentadeuterio-3-(propan-2-ylamino)propan-2-ol (CAS 1189957-99-0) is a chemical compound with the molecular formula C18H29NO3 and a molecular weight of 312.5 g/mol. IUPAC name: 1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-1,1,2,3,3-pentadeuterio-3-(propan-2-ylamino)propan-2-ol. InChIKey: NWIUTZDMDHAVTP-FFNOJTKMSA-N.
| Molecular formula | C18H29NO3 |
|---|---|
| Molecular weight | 312.5 g/mol |
| IUPAC name | 1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-1,1,2,3,3-pentadeuterio-3-(propan-2-ylamino)propan-2-ol |
| InChIKey | NWIUTZDMDHAVTP-FFNOJTKMSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=C(C=C1)CCOCC2CC2)O)NC(C)C |
Computed by PubChem (NCBI)