Products 1330261-21-6
CAS 1330261-21-6 appears in our catalog under these names: Dihydro Capsaicin-d3, >95% (HPLC), Dihydrocapsaicin-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
N-[[4-hydroxy-3-(trideuteriomethoxy)phenyl]methyl]-8-methylnonanamide (CAS 1330261-21-6) is a chemical compound with the molecular formula C18H29NO3 and a molecular weight of 310.4 g/mol. IUPAC name: N-[[4-hydroxy-3-(trideuteriomethoxy)phenyl]methyl]-8-methylnonanamide. InChIKey: XJQPQKLURWNAAH-HPRDVNIFSA-N.
| Molecular formula | C18H29NO3 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | N-[[4-hydroxy-3-(trideuteriomethoxy)phenyl]methyl]-8-methylnonanamide |
| InChIKey | XJQPQKLURWNAAH-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)CNC(=O)CCCCCCC(C)C)O |
Computed by PubChem (NCBI)