Products 748763-03-3

CAS 748763-03-3 is the registry number for Dronedarone Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[3-(dibutylamino)propoxy]benzoic acid (CAS 748763-03-3) is a chemical compound with the molecular formula C18H29NO3 and a molecular weight of 307.4 g/mol. IUPAC name: 4-[3-(dibutylamino)propoxy]benzoic acid. InChIKey: SPPUXULYIUEQMC-UHFFFAOYSA-N.

Identity
Molecular formulaC18H29NO3
Molecular weight307.4 g/mol
IUPAC name4-[3-(dibutylamino)propoxy]benzoic acid
InChIKeySPPUXULYIUEQMC-UHFFFAOYSA-N
SMILESCCCCN(CCCC)CCCOC1=CC=C(C=C1)C(=O)O

Computed by PubChem (NCBI)