CAS 1189961-95-2 appears in our catalog under these names: Desmethyl Atomoxetine-d7 Hydrochloride Salt, >95% (HPLC), Desmethyl atomoxetine-d7 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
3-phenyl-3-[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenoxy]propan-1-amine;hydrochloride (CAS 1189961-95-2) is a chemical compound with the molecular formula C16H20ClNO and a molecular weight of 284.83 g/mol. IUPAC name: 3-phenyl-3-[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenoxy]propan-1-amine;hydrochloride. InChIKey: IIBZNZPMFOWXKB-SVVPHCQTSA-N.
| Molecular formula | C16H20ClNO |
|---|---|
| Molecular weight | 284.83 g/mol |
| IUPAC name | 3-phenyl-3-[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenoxy]propan-1-amine;hydrochloride |
| InChIKey | IIBZNZPMFOWXKB-SVVPHCQTSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])[2H])OC(CCN)C2=CC=CC=C2)[2H])[2H].Cl |
Computed by PubChem (NCBI)