Products 1189966-73-1
CAS 1189966-73-1 appears in our catalog under these names: Ganciclovir–d5, Ganciclovir-d5, Ganciclovir-d5, 98.6%. Offered by: GLPBio, Chemat Brand, TRC, MedChemExpress. Available pack sizes: 1mg, on request, 10mg, 500μg, 1 mg.
2-amino-9-[(1,1,2,3,3-pentadeuterio-1,3-dihydroxypropan-2-yl)oxymethyl]-1H-purin-6-one (CAS 1189966-73-1) is a chemical compound with the molecular formula C9H13N5O4 and a molecular weight of 260.26 g/mol. IUPAC name: 2-amino-9-[(1,1,2,3,3-pentadeuterio-1,3-dihydroxypropan-2-yl)oxymethyl]-1H-purin-6-one. InChIKey: IRSCQMHQWWYFCW-QJWYSIDNSA-N.
| Molecular formula | C9H13N5O4 |
|---|---|
| Molecular weight | 260.26 g/mol |
| IUPAC name | 2-amino-9-[(1,1,2,3,3-pentadeuterio-1,3-dihydroxypropan-2-yl)oxymethyl]-1H-purin-6-one |
| InChIKey | IRSCQMHQWWYFCW-QJWYSIDNSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])O)OCN1C=NC2=C1N=C(NC2=O)N)O |
Computed by PubChem (NCBI)