CAS 93905-80-7 appears in our catalog under these names: Guanosine Impurity 8, N7-(2’,3’,4’-Trihydroxybutyl)guanine, >90%. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 0,5mg, 5mg.
2-amino-7-(2,3,4-trihydroxybutyl)-1H-purin-6-one (CAS 93905-80-7) is a chemical compound with the molecular formula C9H13N5O4 and a molecular weight of 255.23 g/mol. IUPAC name: 2-amino-7-(2,3,4-trihydroxybutyl)-1H-purin-6-one. InChIKey: UMTFQVFOBKFZFN-UHFFFAOYSA-N.
| Molecular formula | C9H13N5O4 |
|---|---|
| Molecular weight | 255.23 g/mol |
| IUPAC name | 2-amino-7-(2,3,4-trihydroxybutyl)-1H-purin-6-one |
| InChIKey | UMTFQVFOBKFZFN-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1CC(C(CO)O)O)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)