CAS 84222-50-4 appears in our catalog under these names: Ganciclovir EP Impurity H, Ganciclovir Impurity 7(Ganciclovir EP Impurity H), 2-Amino-7-(((1,3-dihydroxypropan-2-yl)oxy)methyl)-1,7-dihydro-6H-purin-6-one, 95+%, 2-Amino-7-((2-hydroxy-1-(hydroxymethyl)ethoxy)methyl)-1,7-dihydro-6H-purin-6-one (N-7 Isomer of Ganciclovir). Offered by: Chemat Brand, Hubei YoungXin, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-amino-7-(1,3-dihydroxypropan-2-yloxymethyl)-1H-purin-6-one (CAS 84222-50-4) is a chemical compound with the molecular formula C9H13N5O4 and a molecular weight of 255.23 g/mol. IUPAC name: 2-amino-7-(1,3-dihydroxypropan-2-yloxymethyl)-1H-purin-6-one. InChIKey: NSYYAKAGSCRHJK-UHFFFAOYSA-N.
| Molecular formula | C9H13N5O4 |
|---|---|
| Molecular weight | 255.23 g/mol |
| IUPAC name | 2-amino-7-(1,3-dihydroxypropan-2-yloxymethyl)-1H-purin-6-one |
| InChIKey | NSYYAKAGSCRHJK-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1COC(CO)CO)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)