Products 1189970-31-7
CAS 1189970-31-7 appears in our catalog under these names: rac Felodipine-d3, rac Felodipine-(Methoxy-d3). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
3-O-ethyl 5-O-(trideuteriomethyl) 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 1189970-31-7) is a chemical compound with the molecular formula C18H19Cl2NO4 and a molecular weight of 387.3 g/mol. IUPAC name: 3-O-ethyl 5-O-(trideuteriomethyl) 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: RZTAMFZIAATZDJ-GKOSEXJESA-N.
| Molecular formula | C18H19Cl2NO4 |
|---|---|
| Molecular weight | 387.3 g/mol |
| IUPAC name | 3-O-ethyl 5-O-(trideuteriomethyl) 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | RZTAMFZIAATZDJ-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)C1=C(NC(=C(C1C2=C(C(=CC=C2)Cl)Cl)C(=O)OCC)C)C |
Computed by PubChem (NCBI)
Synonyms:
rac Felodipine-d3, rac Felodipine-(Methoxy-d3)