CAS 119945-59-4 appears in our catalog under these names: (S)-3-Ethyl 5-methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate, 97%, (R)-(+)-Felodipine, >95% (HPLC), (R)-(+)-Felodipine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 1mg, 0,5mg, 2mg, 5mg.
5-O-ethyl 3-O-methyl (4R)-4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 119945-59-4) is a chemical compound with the molecular formula C18H19Cl2NO4 and a molecular weight of 384.2 g/mol. IUPAC name: 5-O-ethyl 3-O-methyl (4R)-4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: RZTAMFZIAATZDJ-OAHLLOKOSA-N.
| Molecular formula | C18H19Cl2NO4 |
|---|---|
| Molecular weight | 384.2 g/mol |
| IUPAC name | 5-O-ethyl 3-O-methyl (4R)-4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | RZTAMFZIAATZDJ-OAHLLOKOSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C([C@H]1C2=C(C(=CC=C2)Cl)Cl)C(=O)OC)C)C |
Computed by PubChem (NCBI)