Products 1219795-30-8
CAS 1219795-30-8 appears in our catalog under these names: (±)-Felodipine-d3 (2,3-dichlorophenyl-d3), 99 atom % D, min 98% Chemical Purity, Felodipine–d3, Felodipine-d3, 99.78%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1mg, 1 mg.
5-O-ethyl 3-O-methyl 4-(2,3-dichloro-4,5,6-trideuteriophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 1219795-30-8) is a chemical compound with the molecular formula C18H19Cl2NO4 and a molecular weight of 387.3 g/mol. IUPAC name: 5-O-ethyl 3-O-methyl 4-(2,3-dichloro-4,5,6-trideuteriophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: RZTAMFZIAATZDJ-AYBVGXBASA-N.
| Molecular formula | C18H19Cl2NO4 |
|---|---|
| Molecular weight | 387.3 g/mol |
| IUPAC name | 5-O-ethyl 3-O-methyl 4-(2,3-dichloro-4,5,6-trideuteriophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | RZTAMFZIAATZDJ-AYBVGXBASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])Cl)Cl)C2C(=C(NC(=C2C(=O)OCC)C)C)C(=O)OC)[2H] |
Computed by PubChem (NCBI)