Products 1189992-73-1

CAS 1189992-73-1 is the registry number for Methyl Clonazepam-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 50 mg, 5 mg.

Structural formula: {0} (CAS {1})

5-(2-chlorophenyl)-7-nitro-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one (CAS 1189992-73-1) is a chemical compound with the molecular formula C16H12ClN3O3 and a molecular weight of 332.75 g/mol. IUPAC name: 5-(2-chlorophenyl)-7-nitro-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one. InChIKey: AZVBJJDUDXZLTM-FIBGUPNXSA-N.

Identity
Molecular formulaC16H12ClN3O3
Molecular weight332.75 g/mol
IUPAC name5-(2-chlorophenyl)-7-nitro-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one
InChIKeyAZVBJJDUDXZLTM-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])N1C(=O)CN=C(C2=C1C=CC(=C2)[N+](=O)[O-])C3=CC=CC=C3Cl

Computed by PubChem (NCBI)