CAS 1189992-73-1 is the registry number for Methyl Clonazepam-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 50 mg, 5 mg.
5-(2-chlorophenyl)-7-nitro-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one (CAS 1189992-73-1) is a chemical compound with the molecular formula C16H12ClN3O3 and a molecular weight of 332.75 g/mol. IUPAC name: 5-(2-chlorophenyl)-7-nitro-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one. InChIKey: AZVBJJDUDXZLTM-FIBGUPNXSA-N.
| Molecular formula | C16H12ClN3O3 |
|---|---|
| Molecular weight | 332.75 g/mol |
| IUPAC name | 5-(2-chlorophenyl)-7-nitro-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one |
| InChIKey | AZVBJJDUDXZLTM-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)CN=C(C2=C1C=CC(=C2)[N+](=O)[O-])C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)