Products 86630-81-1
CAS 86630-81-1 is the registry number for (R)-Meclonazepam. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R)-5-(2-chlorophenyl)-3-methyl-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 86630-81-1) is a chemical compound with the molecular formula C16H12ClN3O3 and a molecular weight of 329.74 g/mol. IUPAC name: (3R)-5-(2-chlorophenyl)-3-methyl-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: LMUVYJCAFWGNSY-SECBINFHSA-N.
| Molecular formula | C16H12ClN3O3 |
|---|---|
| Molecular weight | 329.74 g/mol |
| IUPAC name | (3R)-5-(2-chlorophenyl)-3-methyl-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | LMUVYJCAFWGNSY-SECBINFHSA-N |
| SMILES | C[C@@H]1C(=O)NC2=C(C=C(C=C2)[N+](=O)[O-])C(=N1)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)