Products 58662-84-3
CAS 58662-84-3 appears in our catalog under these names: Meclonazepam, Meclonazepam, 99.97%, Meclonazepam (Standard). Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 1mg, 5mg, 10mM (in 1ml dmso), 25mg, 50mg.
(3S)-5-(2-chlorophenyl)-3-methyl-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 58662-84-3) is a chemical compound with the molecular formula C16H12ClN3O3 and a molecular weight of 329.74 g/mol. IUPAC name: (3S)-5-(2-chlorophenyl)-3-methyl-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: LMUVYJCAFWGNSY-VIFPVBQESA-N.
| Molecular formula | C16H12ClN3O3 |
|---|---|
| Molecular weight | 329.74 g/mol |
| IUPAC name | (3S)-5-(2-chlorophenyl)-3-methyl-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | LMUVYJCAFWGNSY-VIFPVBQESA-N |
| SMILES | C[C@H]1C(=O)NC2=C(C=C(C=C2)[N+](=O)[O-])C(=N1)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)