CAS 1189994-89-5 appears in our catalog under these names: rac 5-Hydroxy Valproic Acid-d7 Sodium Salt, Valproic acid-d7 (sodium). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
Sodium 3,3,4,4,5,5,5-heptadeuterio-2-(3-hydroxypropyl)pentanoate (CAS 1189994-89-5) is a chemical compound with the molecular formula C8H15NaO3 and a molecular weight of 189.24 g/mol. IUPAC name: sodium 3,3,4,4,5,5,5-heptadeuterio-2-(3-hydroxypropyl)pentanoate. InChIKey: CSZWWXWOLIYBAB-MDVNJVHASA-M.
| Molecular formula | C8H15NaO3 |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | sodium 3,3,4,4,5,5,5-heptadeuterio-2-(3-hydroxypropyl)pentanoate |
| InChIKey | CSZWWXWOLIYBAB-MDVNJVHASA-M |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C(CCCO)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)