CAS 2270912-50-8 appears in our catalog under these names: 2-(2-Hydroxyethyl)-4-methylpentanoate sodium salt, 95%, Sodium 2-(2-hydroxyethyl)-4-methylpentanoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Sodium 2-(2-hydroxyethyl)-4-methylpentanoate (CAS 2270912-50-8) is a chemical compound with the molecular formula C8H15NaO3 and a molecular weight of 182.19 g/mol. IUPAC name: sodium 2-(2-hydroxyethyl)-4-methylpentanoate. InChIKey: BEIQARRVEAETBY-UHFFFAOYSA-M.
| Molecular formula | C8H15NaO3 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | sodium 2-(2-hydroxyethyl)-4-methylpentanoate |
| InChIKey | BEIQARRVEAETBY-UHFFFAOYSA-M |
| SMILES | CC(C)CC(CCO)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)