CAS 50996-94-6 is the registry number for Sodium 4-hydroxyoctanoate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Sodium 4-hydroxyoctanoate (CAS 50996-94-6) is a chemical compound with the molecular formula C8H15NaO3 and a molecular weight of 182.19 g/mol. IUPAC name: sodium 4-hydroxyoctanoate. InChIKey: XLBTUYAGSXTHPF-UHFFFAOYSA-M.
| Molecular formula | C8H15NaO3 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | sodium 4-hydroxyoctanoate |
| InChIKey | XLBTUYAGSXTHPF-UHFFFAOYSA-M |
| SMILES | CCCCC(CCC(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)