CAS 119-19-7 appears in our catalog under these names: 7–Anilino–1–naphthol–3–sulfonic Acid, 7-Anilino-1-naphthol-3-sulfonic acid, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 5g, 25g.
6-anilino-4-hydroxynaphthalene-2-sulfonic acid (CAS 119-19-7) is a chemical compound with the molecular formula C16H13NO4S and a molecular weight of 315.3 g/mol. IUPAC name: 6-anilino-4-hydroxynaphthalene-2-sulfonic acid. InChIKey: QEAYLNJEDDOYNQ-UHFFFAOYSA-N.
| Molecular formula | C16H13NO4S |
|---|---|
| Molecular weight | 315.3 g/mol |
| IUPAC name | 6-anilino-4-hydroxynaphthalene-2-sulfonic acid |
| InChIKey | QEAYLNJEDDOYNQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC3=C(C=C(C=C3C=C2)S(=O)(=O)O)O |
Computed by PubChem (NCBI)