CAS 370090-66-7 is the registry number for 1-Tosyl-1H-indole-3-carboxylic acid, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
1-(4-methylphenyl)sulfonylindole-3-carboxylic acid (CAS 370090-66-7) is a chemical compound with the molecular formula C16H13NO4S and a molecular weight of 315.3 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylindole-3-carboxylic acid. InChIKey: IMYNPWUFTCRYQY-UHFFFAOYSA-N.
| Molecular formula | C16H13NO4S |
|---|---|
| Molecular weight | 315.3 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylindole-3-carboxylic acid |
| InChIKey | IMYNPWUFTCRYQY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)