CAS 181696-35-5 appears in our catalog under these names: 4-(5-Methyl-3-phenylisoxazol-4-yl)benzenesulfonic acid, 95%, Valdecoxib Impurity 33, Valdecoxib Sulfonic Acid, >95% (HPLC), 4–(5–Methyl–3–phenylisoxazol–4–yl)benzenesulfonic acid, 4-(5-Methyl-3-Phenylisoxazol-4-Yl)Benzenesulfonic Acid, 98%, 98%. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 5g, on request, 25mg, 100mg.
4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonic acid (CAS 181696-35-5) is a chemical compound with the molecular formula C16H13NO4S and a molecular weight of 315.3 g/mol. IUPAC name: 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonic acid. InChIKey: LLWOSCPRJRUVST-UHFFFAOYSA-N.
| Molecular formula | C16H13NO4S |
|---|---|
| Molecular weight | 315.3 g/mol |
| IUPAC name | 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonic acid |
| InChIKey | LLWOSCPRJRUVST-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C3=CC=C(C=C3)S(=O)(=O)O |
Computed by PubChem (NCBI)