Products 1190003-63-4
CAS 1190003-63-4 appears in our catalog under these names: Amobarbital-d5, >95% (HPLC), Amobarbital-d5 (ethyl-d5), 99 atom % D, min 98% Chemical Purity, Amobarbital–d5. Offered by: TRC, CDN, GLPBio. Available pack sizes: 10mg, 1mg, 0,05g, 0,01g.
5-(3-methylbutyl)-5-(1,1,2,2,2-pentadeuterioethyl)-1,3-diazinane-2,4,6-trione (CAS 1190003-63-4) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 231.30 g/mol. IUPAC name: 5-(3-methylbutyl)-5-(1,1,2,2,2-pentadeuterioethyl)-1,3-diazinane-2,4,6-trione. InChIKey: VIROVYVQCGLCII-SGEUAGPISA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 231.30 g/mol |
| IUPAC name | 5-(3-methylbutyl)-5-(1,1,2,2,2-pentadeuterioethyl)-1,3-diazinane-2,4,6-trione |
| InChIKey | VIROVYVQCGLCII-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1(C(=O)NC(=O)NC1=O)CCC(C)C |
Computed by PubChem (NCBI)
Synonyms:
Amobarbital-d5, Amobarbital-d5 (ethyl-d5)