Products 1190006-35-9
CAS 1190006-35-9 appears in our catalog under these names: tert-Butyl-d9 4-Nitrophenyl Carbonate, >95% (HPLC), tert-Butyl 4-Nitrophenyl Carbonate-d9. Offered by: TRC, MedChemExpress. Available pack sizes: 500mg, 50mg, 100 mg, 50 mg, 500 mg.
[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl] (4-nitrophenyl) carbonate (CAS 1190006-35-9) is a chemical compound with the molecular formula C11H13NO5 and a molecular weight of 248.28 g/mol. IUPAC name: [1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl] (4-nitrophenyl) carbonate. InChIKey: XNPGBDJTEBCMHA-GQALSZNTSA-N.
| Molecular formula | C11H13NO5 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | [1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl] (4-nitrophenyl) carbonate |
| InChIKey | XNPGBDJTEBCMHA-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])OC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)