Products 13303-10-1
CAS 13303-10-1 appears in our catalog under these names: 1,1-Dimethylethyl 4-nitrophenyl carbonate, 98%, 98%, tert-Butyl (4-nitrophenyl) carbonate. Offered by: Chemat, Fluorochem. Available pack sizes: 5mg.
Tert-butyl (4-nitrophenyl) carbonate (CAS 13303-10-1) is a chemical compound with the molecular formula C11H13NO5 and a molecular weight of 239.22 g/mol. IUPAC name: tert-butyl (4-nitrophenyl) carbonate. InChIKey: XNPGBDJTEBCMHA-UHFFFAOYSA-N.
| Molecular formula | C11H13NO5 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | tert-butyl (4-nitrophenyl) carbonate |
| InChIKey | XNPGBDJTEBCMHA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)