CAS 1190017-10-7 appears in our catalog under these names: 2-Bromoethyl-4-nitrophenyl Ether-d4, 1-(2-Bromoethoxy)-4-nitrobenzene-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 25 mg, 10 mg, 100 mg, 5 mg, 50 mg.
1-(2-bromo-1,1,2,2-tetradeuterioethoxy)-4-nitrobenzene (CAS 1190017-10-7) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 250.08 g/mol. IUPAC name: 1-(2-bromo-1,1,2,2-tetradeuterioethoxy)-4-nitrobenzene. InChIKey: YQWCBDNNEZHPMA-NZLXMSDQSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 250.08 g/mol |
| IUPAC name | 1-(2-bromo-1,1,2,2-tetradeuterioethoxy)-4-nitrobenzene |
| InChIKey | YQWCBDNNEZHPMA-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])Br)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)