CAS 119005-80-0 is the registry number for 3,4-Di-O-acetyl-1,6-anhydro-2-azido-2-deoxy-β-D-glucopyranose. Offered by: Chemat. Available pack sizes: 1g, 250mg, 2g, 500mg.
[(1R,2S,3R,4R,5R)-3-acetyloxy-4-azido-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate (CAS 119005-80-0) is a chemical compound with the molecular formula C10H13N3O6 and a molecular weight of 271.23 g/mol. IUPAC name: [(1R,2S,3R,4R,5R)-3-acetyloxy-4-azido-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate. InChIKey: WQIXFBBVGSVFBH-VVULQXIFSA-N.
| Molecular formula | C10H13N3O6 |
|---|---|
| Molecular weight | 271.23 g/mol |
| IUPAC name | [(1R,2S,3R,4R,5R)-3-acetyloxy-4-azido-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate |
| InChIKey | WQIXFBBVGSVFBH-VVULQXIFSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H]2CO[C@H](O2)[C@@H]([C@H]1OC(=O)C)N=[N+]=[N-] |
Computed by PubChem (NCBI)