CAS 346704-15-2 is the registry number for 2–(2–((2,4–Dinitrophenyl)amino)ethoxy)ethan–1–ol. Offered by: GLPBio. Available pack sizes: 1g, 250mg, 500mg.
2-[2-(2,4-dinitroanilino)ethoxy]ethanol (CAS 346704-15-2) is a chemical compound with the molecular formula C10H13N3O6 and a molecular weight of 271.23 g/mol. IUPAC name: 2-[2-(2,4-dinitroanilino)ethoxy]ethanol. InChIKey: BZKSZLFZNKXAMR-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O6 |
|---|---|
| Molecular weight | 271.23 g/mol |
| IUPAC name | 2-[2-(2,4-dinitroanilino)ethoxy]ethanol |
| InChIKey | BZKSZLFZNKXAMR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NCCOCCO |
Computed by PubChem (NCBI)