Products 1190305-94-2

CAS 1190305-94-2 is the registry number for 4-Amino-1-(4-methoxyphenyl)-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

4-amino-1-(4-methoxyphenyl)pyrazole-3-carboxylic acid (CAS 1190305-94-2) is a chemical compound with the molecular formula C11H11N3O3 and a molecular weight of 233.22 g/mol. IUPAC name: 4-amino-1-(4-methoxyphenyl)pyrazole-3-carboxylic acid. InChIKey: HYVQKYMBTLXQNX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11N3O3
Molecular weight233.22 g/mol
IUPAC name4-amino-1-(4-methoxyphenyl)pyrazole-3-carboxylic acid
InChIKeyHYVQKYMBTLXQNX-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)N2C=C(C(=N2)C(=O)O)N

Computed by PubChem (NCBI)