Products 1190312-13-0
CAS 1190312-13-0 appears in our catalog under these names: 3-Chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid, 95%+, 95%+, 3-Chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid, 95+%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 1g, 250mg.
3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid (CAS 1190312-13-0) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid. InChIKey: JGSIZSKEMQQNFL-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 3-chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid |
| InChIKey | JGSIZSKEMQQNFL-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1NC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)