CAS 1190314-33-0 appears in our catalog under these names: 2-Cyclobutyl-4-oxazolecarboxylic Acid, 2-Cyclobutyl-1,3-oxazole-4-carboxylic acid. Offered by: TRC, Biosynth. Available pack sizes: 1g, 0,5g, 2g, 5g, 10g.
2-cyclobutyl-1,3-oxazole-4-carboxylic acid (CAS 1190314-33-0) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2-cyclobutyl-1,3-oxazole-4-carboxylic acid. InChIKey: BHGYEFGSVNXEME-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2-cyclobutyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | BHGYEFGSVNXEME-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=NC(=CO2)C(=O)O |
Computed by PubChem (NCBI)