CAS 1190317-72-6 appears in our catalog under these names: 5,6-Dichloro-1h-pyrrolo[2,3-b]pyridine, 95%, 5,6–Dichloro–1H–pyrrolo(2,3–b)pyridine, 5,6-Dichloro-1H-pyrrolo[2,3-b]pyridine, 95%, 95%, 5,6-Dichloro-1H-pyrrolo[2,3-b]pyridine, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
5,6-dichloro-1H-pyrrolo[2,3-b]pyridine (CAS 1190317-72-6) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 5,6-dichloro-1H-pyrrolo[2,3-b]pyridine. InChIKey: NPFVCHKGYRYJQK-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 5,6-dichloro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | NPFVCHKGYRYJQK-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC(=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)