CAS 1190321-24-4 appears in our catalog under these names: 5-methyl-3-nitro-1H-pyrrolo(2,3-b)pyridine, 97%, 5-Methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine, 96%, 96%, 5-Methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 10g, 250mg, 1g.
5-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine (CAS 1190321-24-4) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 5-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine. InChIKey: OWGGSXQRLHNDGC-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | OWGGSXQRLHNDGC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(NC=C2[N+](=O)[O-])N=C1 |
Computed by PubChem (NCBI)