CAS 1190322-07-6 is the registry number for 5,6-Dibromo-1H-pyrrolo[2,3-b]pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5,6-dibromo-1H-pyrrolo[2,3-b]pyridine (CAS 1190322-07-6) is a chemical compound with the molecular formula C7H4Br2N2 and a molecular weight of 275.93 g/mol. IUPAC name: 5,6-dibromo-1H-pyrrolo[2,3-b]pyridine. InChIKey: VTDJWYBQQBSZSM-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2 |
|---|---|
| Molecular weight | 275.93 g/mol |
| IUPAC name | 5,6-dibromo-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | VTDJWYBQQBSZSM-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC(=C(C=C21)Br)Br |
Computed by PubChem (NCBI)